|
CAS#: 19891-75-9 Product: psi,psi-Carotene-16,16'-diol No suppilers available for the product. |
| Name | psi,psi-Carotene-16,16'-diol |
|---|---|
| Synonyms | (1E,1'E)-ψ,ψ-carotene #; all-trans-Lycophyll; Lycopene-16,16'-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56O2 |
| Molecular Weight | 568.87 |
| CAS Registry Number | 19891-75-9 |
| SMILES | C/C(=C\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C=C(\CC/C=C(/CO)\C)/C)/C)/C)\C)\C)/CC/C=C(/CO)\C |
| InChI | 1S/C40H56O2/c1-33(19-11-21-35(3)23-13-25-37(5)27-15-29-39(7)31-41)17-9-10-18-34(2)20-12-22-36(4)24-14-26-38(6)28-16-30-40(8)32-42/h9-14,17-26,29-30,41-42H,15-16,27-28,31-32H2,1-8H3/b10-9+,19-11+,20-12+,23-13+,24-14+,33-17+,34-18+,35-21+,36-22+,37-25+,38-26+,39-29+,40-30+ |
| InChIKey | JEVVKJMRZMXFBT-CCHFXWJWSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 727.1±55.0°C at 760 mmHg (Cal.) |
| Flash point | 277.6±26.1°C (Cal.) |
| Refractive index | 1.547 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for psi,psi-Carotene-16,16'-diol |