Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Benzo(e)naphtho(2,3-a)pyrene |
|---|---|
| Synonyms | Naphto(1,2-C-D-E)Naphtacene [French]; Benzo[A]Naphtho[8,1,2-Cde]Naphthacene; Benzo[E]Naphtho[2,3-A]Pyrene |
| Molecular Structure |  |
| Molecular Formula | C28H16 |
| Molecular Weight | 352.43 |
| CAS Registry Number | 192-70-1 |
| SMILES | C1=C6C4=C(C2=CC3=C(C=C12)C=CC=C3)C=CC5=C4C(=CC=C5)C7=C6C=CC=C7 |
| InChI | 1S/C28H16/c1-2-7-19-15-25-20(14-18(19)6-1)16-26-22-10-4-3-9-21(22)23-11-5-8-17-12-13-24(25)28(26)27(17)23/h1-16H |
| InChIKey | YEVOPXRNZORJGM-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.299°C at 760 mmHg (Cal.) |
| Flash point | 330.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzo(e)naphtho(2,3-a)pyrene |