| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Benzo[b]Naphtho[2,3-d]Furan |
|---|---|
| Synonyms | Naphtho[3,2-B]Benzofuran; Zinc04262222; Inchi=1/C16h10o/C1-2-6-12-10-16-14(9-11(12)5-1)13-7-3-4-8-15(13)17-16/H1-10 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 |
| CAS Registry Number | 243-42-5 |
| EINECS | 205-955-9 |
| SMILES | C1=C4C(=CC2=C1C3=C(O2)C=CC=C3)C=CC=C4 |
| InChI | 1S/C16H10O/c1-2-6-12-10-16-14(9-11(12)5-1)13-7-3-4-8-15(13)17-16/h1-10H |
| InChIKey | FTMRMQALUDDFQO-UHFFFAOYSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.058°C at 760 mmHg (Cal.) |
| Flash point | 208.275°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzo[b]Naphtho[2,3-d]Furan |