| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | Calcium Glutamate |
| Synonyms | Calcium (2S)-2-Aminoglutarate; Calcium L-Glutamate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7CaNO4 |
| Molecular Weight | 185.19 |
| CAS Registry Number | 19238-49-4 |
| EINECS | 242-905-5 |
| SMILES | [C@@H](N)(C([O-])=O)CCC([O-])=O.[Ca++] |
| InChI | 1S/C5H9NO4.Ca/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+2/p-2/t3-;/m0./s1 |
| InChIKey | NIDRASOKXCQPKX-DFWYDOINSA-L |
| Boiling point | 333.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Calcium Glutamate |