| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | [1,1'-Biphenyl]-2,2',3,3'-Tetrol |
|---|---|
| Synonyms | 3-(2,3-Dihydroxyphenyl)Pyrocatechol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 19261-03-1 |
| SMILES | C2=C(C1=CC=CC(=C1O)O)C(=C(O)C=C2)O |
| InChI | 1S/C12H10O4/c13-9-5-1-3-7(11(9)15)8-4-2-6-10(14)12(8)16/h1-6,13-16H |
| InChIKey | AIEZFWSIZQLXEG-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.408°C at 760 mmHg (Cal.) |
| Flash point | 227.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1,1'-Biphenyl]-2,2',3,3'-Tetrol |