Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | [1,1'-Biphenyl]Triol |
|---|---|
| Synonyms | 5-Phenylpyrogallol; (1,1'-Biphenyl)Triol; 1,2,4-Benzenetriol, Phenyl- |
| Molecular Structure | ![CAS#: 29222-39-7， [1,1'-Biphenyl]Triol](/moreStructures/29222-39-7.gif) |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 29222-39-7 |
| EINECS | 249-523-8 |
| SMILES | C1=C(C(=C(C=C1C2=CC=CC=C2)O)O)O |
| InChI | 1S/C12H10O3/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h1-7,13-15H |
| InChIKey | IVQGJZCJWJVSJX-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.263°C at 760 mmHg (Cal.) |
| Flash point | 221.466°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1,1'-Biphenyl]Triol |