Online Database of Chemicals from Around the World
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6141-5566 / 800-819-3336 | |||
 |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| VDM Biochemicals | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (330) 252-8181/ | |||
|
sales@vdmbio.com,info@vdmbio.com | |||
| Chemical manufacturer | ||||
| Name | 4-Nitrophenyl Valerate |
|---|---|
| Synonyms | Pentanoic acid 4-nitrophenyl ester; P-NITROPHENYLVALERATE; N4377_SIGMA |
| Molecular Structure |  |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 1956-07-6 |
| SMILES | O=C(Oc1ccc(cc1)[N+]([O-])=O)CCCC |
| InChI | 1S/C11H13NO4/c1-2-3-4-11(13)16-10-7-5-9(6-8-10)12(14)15/h5-8H,2-4H2,1H3 |
| InChIKey | RJQXEHRFVKJLJO-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.027°C at 760 mmHg (Cal.) |
| Flash point | 145.47°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl Valerate |