Online Database of Chemicals from Around the World
|
CAS#: 5535-55-7 Product: 4-Nitrophenylvinyl Sulfone No suppilers available for the product. |
| Name | 4-Nitrophenylvinyl Sulfone |
|---|---|
| Synonyms | 1-Nitro-4-Vinylsulfonyl-Benzene; 1-Nitro-4-Vinylsulfonylbenzene; 1-Ethenylsulfonyl-4-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C8H7NO4S |
| Molecular Weight | 213.21 |
| CAS Registry Number | 5535-55-7 |
| SMILES | C1=CC(=CC=C1[S](=O)(=O)C=C)[N+]([O-])=O |
| InChI | 1S/C8H7NO4S/c1-2-14(12,13)8-5-3-7(4-6-8)9(10)11/h2-6H,1H2 |
| InChIKey | MZKZSNKRTIDCRI-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.529°C at 760 mmHg (Cal.) |
| Flash point | 201.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenylvinyl Sulfone |