|
CAS#: 4264-29-3 Product: 1-Nitro-2-[(E)-2-Phenylvinyl]Benzene No suppilers available for the product. |
| Name | 1-Nitro-2-[(E)-2-Phenylvinyl]Benzene |
|---|---|
| Synonyms | 1-Nitro-2-[(E)-2-phenylethenyl]benzene; 1-Nitro-2-[(E)-2-phenylethenyl]benzene #; 4-Nitrostilben |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 |
| CAS Registry Number | 4264-29-3 |
| SMILES | O=[N+]([O-])c2ccccc2\C=C\c1ccccc1 |
| InChI | 1S/C14H11NO2/c16-15(17)14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-11H/b11-10+ |
| InChIKey | RYJATPLJVSILLB-ZHACJKMWSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.333°C at 760 mmHg (Cal.) |
| Flash point | 173.056°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-2-[(E)-2-Phenylvinyl]Benzene |