| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Isoleucine derivative |
|---|---|
| Name | N-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Isoleucine |
| Synonyms | (2S,3S)-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.39 |
| CAS Registry Number | 197245-22-0 |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OCC1=CC2=CC=CC=C2S1(=O)=O |
| InChI | 1S/C16H19NO6S/c1-3-10(2)14(15(18)19)17-16(20)23-9-12-8-11-6-4-5-7-13(11)24(12,21)22/h4-8,10,14H,3,9H2,1-2H3,(H,17,20)(H,18,19)/t10-,14-/m0/s1 |
| InChIKey | IOTFSDWKSLUDSZ-HZMBPMFUSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 97-100°C (Expl.) |
| Boiling point | 606.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 320.6±31.5°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Isoleucine |