| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Asparagine derivatives |
|---|---|
| Name | N2-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Asparagine |
| Synonyms | (2S)-2-{[ |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O7S |
| Molecular Weight | 354.34 |
| CAS Registry Number | 197245-31-1 |
| SMILES | C1=CC=C2C(=C1)C=C(S2(=O)=O)COC(=O)N[C@@H](CC(=O)N)C(=O)O |
| InChI | 1S/C14H14N2O7S/c15-12(17)6-10(13(18)19)16-14(20)23-7-9-5-8-3-1-2-4-11(8)24(9,21)22/h1-5,10H,6-7H2,(H2,15,17)(H,16,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | SAYGRVJKBKWLHI-JTQLQIEISA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 134-138°C (Expl.) |
| Boiling point | 757.7±60.0°C at 760 mmHg (Cal.) |
| Flash point | 412.0±32.9°C (Cal.) |
| Refractive index | 1.63 (Cal.) |
| Safety Code | S22;S24/25 Details |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for N2-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Asparagine |