| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Methionine derivatives |
|---|---|
| Name | N-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Methionine |
| Synonyms | (2S)-2-{[ |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO6S2 |
| Molecular Weight | 371.43 |
| CAS Registry Number | 197245-29-7 |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)OCC1=CC2=CC=CC=C2S1(=O)=O |
| InChI | 1S/C15H17NO6S2/c1-23-7-6-12(14(17)18)16-15(19)22-9-11-8-10-4-2-3-5-13(10)24(11,20)21/h2-5,8,12H,6-7,9H2,1H3,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | RBUIRQRLLHQRDV-LBPRGKRZSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 116°C (Expl.) |
| Boiling point | 670.5±55.0°C at 760 mmHg (Cal.) |
| Flash point | 359.3±31.5°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Methionine |