Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,3,10B-Tetrahydrofluoranthene |
|---|---|
| Synonyms | Inchi=1/C16h14/C1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/H1-3,5,7-9,15H,4,6,10H; 1,2,3,4-Tetrahydrofluoranthene; Fluoranthene, 1,2,3,10B-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 20279-21-4 |
| EINECS | 243-672-2 |
| SMILES | C1=CC=C3C2=C1C4=C(C2CCC3)C=CC=C4 |
| InChI | 1S/C16H14/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-3,5,7-9,15H,4,6,10H2 |
| InChIKey | VMBZUGDYWLFLEU-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Melting point | 76°C (Expl.) |
| Boiling point | 353.466°C at 760 mmHg (Cal.) |
| Flash point | 179.439°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3,10B-Tetrahydrofluoranthene |