Online Database of Chemicals from Around the World
|
CAS#: 67990-29-8 Product: 2,3,4,6alpha-Tetrahydro-1H-1,3alpha-Ethanopentalen-3-Yl Propionate No suppilers available for the product. |
| Name | 2,3,4,6alpha-Tetrahydro-1H-1,3alpha-Ethanopentalen-3-Yl Propionate |
|---|---|
| Synonyms | 1H-1,3A-Ethanopentalen-3-Ol, 2,3,4,6A-Tetrahydro-, Propanoate |
| Molecular Structure |  |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 67990-29-8 |
| EINECS | 268-050-8 |
| SMILES | C(C(OC3C12CC=CC1C(CC2)C3)=O)C |
| InChI | 1S/C13H18O2/c1-2-12(14)15-11-8-9-5-7-13(11)6-3-4-10(9)13/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | GNSJBXUKHHNIFD-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.073°C at 760 mmHg (Cal.) |
| Flash point | 116.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,6alpha-Tetrahydro-1H-1,3alpha-Ethanopentalen-3-Yl Propionate |