Online Database of Chemicals from Around the World
|
CAS#: 24139-33-1 Product: 1,2,3,4-Tetrahydro-4a,8alpha-Ethenonaphthalene No suppilers available for the product. |
| Name | 1,2,3,4-Tetrahydro-4a,8alpha-Ethenonaphthalene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 |
| CAS Registry Number | 24139-33-1 |
| SMILES | C3C12C(C=C1)(C=CC=C2)CCC3 |
| InChI | 1S/C12H14/c1-2-6-12-8-4-3-7-11(12,5-1)9-10-12/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | PATIUEOBXCLCSQ-UHFFFAOYSA-N |
| Density | 1.046g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.262°C at 760 mmHg (Cal.) |
| Flash point | 91.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-4a,8alpha-Ethenonaphthalene |