Online Database of Chemicals from Around the World
|
CAS#: 511-21-7 Product: (5beta)-Ergostane No suppilers available for the product. |
| Name | (5beta)-Ergostane |
|---|---|
| Synonyms | (5β)-ergostane; 5β-ergostane; ergostane, (5β)- |
| Molecular Structure |  |
| Molecular Formula | C28H50 |
| Molecular Weight | 386.70 |
| CAS Registry Number | 511-21-7 |
| SMILES | [C@H]41CCCC[C@@]1([C@@H]3[C@H]([C@@H]2CC[C@@H]([C@@]2(C)CC3)[C@H](C)CC[C@H](C)C(C)C)CC4)C |
| InChI | 1S/C28H50/c1-19(2)20(3)10-11-21(4)24-14-15-25-23-13-12-22-9-7-8-17-27(22,5)26(23)16-18-28(24,25)6/h19-26H,7-18H2,1-6H3/t20-,21+,22-,23-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | WAAWMJYYKITCGF-XRWQUZPPSA-N |
| Density | 0.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.875°C at 760 mmHg (Cal.) |
| Flash point | 216.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5beta)-Ergostane |