Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,3,4,5-Pentachloro-6-(Chloromethyl)Benzene |
|---|---|
| Synonyms | Nciopen2_004947; Nsc85645; Alpha,2,3,4,5,6-Hexachlorotoluene |
| Molecular Structure |  |
| Molecular Formula | C7H2Cl6 |
| Molecular Weight | 298.81 |
| CAS Registry Number | 2136-78-9 |
| SMILES | C(C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C7H2Cl6/c8-1-2-3(9)5(11)7(13)6(12)4(2)10/h1H2 |
| InChIKey | ZULBFSSEZXLFIV-UHFFFAOYSA-N |
| Density | 1.689g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.274°C at 760 mmHg (Cal.) |
| Flash point | 164.173°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentachloro-6-(Chloromethyl)Benzene |