Online Database of Chemicals from Around the World
| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (203) 786-5290 | |||
 |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,4,7,8-Pentachlorodibenzo-P-Dioxin |
|---|---|
| Synonyms | 1,2,4,7,8-Pentachlorodibenzo-P-Dioxin; Brn 1627438; Dibenzo-P-Dioxin, 1,2,4,7,8-Pentachloro- |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl5O2 |
| Molecular Weight | 356.42 |
| CAS Registry Number | 58802-08-7 |
| SMILES | C3=C(C1=C(OC2=C(O1)C=C(C(=C2)Cl)Cl)C(=C3Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O2/c13-4-2-8-9(3-5(4)14)19-12-10(17)6(15)1-7(16)11(12)18-8/h1-3H |
| InChIKey | QUPLGUUISJOUPJ-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.93°C at 760 mmHg (Cal.) |
| Flash point | 171.719°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,4,7,8-Pentachlorodibenzo-P-Dioxin |