|
CAS#: 5659-47-2 Product: 2,3,4,4,5-Pentachlorocyclopent-2-En-1-One No suppilers available for the product. |
| Name | 2,3,4,4,5-Pentachlorocyclopent-2-En-1-One |
|---|---|
| Synonyms | 2,3,4,4,5-Pentachloro-1-Cyclopent-2-Enone |
| Molecular Structure | ![]() |
| Molecular Formula | C5HCl5O |
| Molecular Weight | 254.33 |
| CAS Registry Number | 5659-47-2 |
| EINECS | 227-108-2 |
| SMILES | O=C1C(C(C(=C1Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C5HCl5O/c6-1-2(11)4(8)5(9,10)3(1)7/h4H |
| InChIKey | OCLLQGWDUVFOFT-UHFFFAOYSA-N |
| Density | 1.791g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.186°C at 760 mmHg (Cal.) |
| Flash point | 105.918°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3,4,4,5-Pentachlorocyclopent-2-En-1-One |