Online Database of Chemicals from Around the World
| Name | Butyl 2,3,4,4,4-Pentachlorocrotonate |
|---|---|
| Synonyms | Butyl 2,3,4,4,4-Pentachlorobut-2-Enoate; (E)-2,3,4,4,4-Pentachlorobut-2-Enoic Acid Butyl Ester; 2,3,4,4,4-Pentachlorobut-2-Enoic Acid Butyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H9Cl5O2 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 21824-93-1 |
| EINECS | 244-594-1 |
| SMILES | C(OC(\C(=C(C(Cl)(Cl)Cl)/Cl)Cl)=O)CCC |
| InChI | 1S/C8H9Cl5O2/c1-2-3-4-15-7(14)5(9)6(10)8(11,12)13/h2-4H2,1H3/b6-5+ |
| InChIKey | XZSVYPVMTCFPMI-AATRIKPKSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.683°C at 760 mmHg (Cal.) |
| Flash point | 114.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl 2,3,4,4,4-Pentachlorocrotonate |
