| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | n-Butyl Pentafluoropropionate |
|---|---|
| Synonyms | Pentafluoropropionicacidbutylester; N-BUTYL PENTAFLUOROPROPIONATE |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9F5O2 |
| Molecular Weight | 220.14 |
| CAS Registry Number | 680-28-4 |
| SMILES | CCCCOC(=O)C(C(F)(F)F)(F)F |
| InChI | 1S/C7H9F5O2/c1-2-3-4-14-5(13)6(8,9)7(10,11)12/h2-4H2,1H3 |
| Market Analysis Reports |
| List of Reports Available for n-Butyl Pentafluoropropionate |