Online Database of Chemicals from Around the World
|
CAS#: 75147-20-5 Product: Butyl 2,2,3,4,4-Pentachlorobut-3-Enoate No suppilers available for the product. |
| Name | Butyl 2,2,3,4,4-Pentachlorobut-3-Enoate |
|---|---|
| Synonyms | 2,2,3,4,4-Pentachlorobut-3-Enoic Acid Butyl Ester; 2,2,3,4,4-Pentachloro-3-Butenoic Acid, N-Butyl Ester; 3-Butenoic Acid, 2,2,3,4,4-Pentachloro-, Butyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H9Cl5O2 |
| Molecular Weight | 314.42 |
| CAS Registry Number | 75147-20-5 |
| EINECS | 278-078-2 |
| SMILES | C(OC(C(Cl)(C(=C(Cl)Cl)Cl)Cl)=O)CCC |
| InChI | 1S/C8H9Cl5O2/c1-2-3-4-15-7(14)8(12,13)5(9)6(10)11/h2-4H2,1H3 |
| InChIKey | JZJILZTVTMMGAR-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.225°C at 760 mmHg (Cal.) |
| Flash point | 127.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl 2,2,3,4,4-Pentachlorobut-3-Enoate |