Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Acenaphtho[3,4-d][1,3]Thiazole |
|---|---|
| Molecular Structure | ![CAS#: 219-87-4， Acenaphtho[3,4-d][1,3]Thiazole](/moreStructures/219-87-4.gif) |
| Molecular Formula | C13H7NS |
| Molecular Weight | 209.27 |
| CAS Registry Number | 219-87-4 |
| SMILES | C1=CC2=CC3=C(C4=C2C(=C1)C=C4)N=CS3 |
| InChI | 1S/C13H7NS/c1-2-8-4-5-10-12(8)9(3-1)6-11-13(10)14-7-15-11/h1-7H |
| InChIKey | ZPFUTADSJSNZKV-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.3±14.0°C at 760 mmHg (Cal.) |
| Flash point | 218.5±9.0°C (Cal.) |
| Refractive index | 1.865 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acenaphtho[3,4-d][1,3]Thiazole |