Online Database of Chemicals from Around the World
|
CAS#: 5088-53-9 Product: 1(2H)-Acenaphthylenone Oxime No suppilers available for the product. |
| Name | 1(2H)-Acenaphthylenone Oxime |
|---|---|
| Synonyms | Nsc31682; Zinc05257534 |
| Molecular Structure |  |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 |
| CAS Registry Number | 5088-53-9 |
| SMILES | C3=C1C/C(C2=C1C(=CC=C2)C=C3)=N/O |
| InChI | 1S/C12H9NO/c14-13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,14H,7H2/b13-11- |
| InChIKey | YBYBQPOXHIHVOX-QBFSEMIESA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.867°C at 760 mmHg (Cal.) |
| Flash point | 255.131°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1(2H)-Acenaphthylenone Oxime |