Online Database of Chemicals from Around the World
|
CAS#: 71735-33-6 Product: 1,2,3,4,5,6,7,8-Acenaphthyleneoctol No suppilers available for the product. |
| Name | 1,2,3,4,5,6,7,8-Acenaphthyleneoctol |
|---|---|
| Synonyms | acenaphthyleneoctol |
| Molecular Structure |  |
| Molecular Formula | C12H8O8 |
| Molecular Weight | 280.19 |
| CAS Registry Number | 71735-33-6 |
| EINECS | 275-945-7 |
| SMILES | Oc3c(O)c(O)c1c(O)c(O)c(O)c2C(O)=C(O)c3c12 |
| InChI | 1S/C12H8O8/c13-5-2-1-3(6(5)14)8(16)12(20)10(18)4(1)9(17)11(19)7(2)15/h13-20H |
| InChIKey | HIJOIWPXNMMCST-UHFFFAOYSA-N |
| Density | 2.577g/cm3 (Cal.) |
|---|---|
| Boiling point | 832.479°C at 760 mmHg (Cal.) |
| Flash point | 411.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6,7,8-Acenaphthyleneoctol |