Online Database of Chemicals from Around the World
|
CAS#: 21982-83-2 Product: Cumambrin B No suppilers available for the product. |
| Name | Cumambrin B |
|---|---|
| Synonyms | 4,6-Dihydroxy-6,9-Dimethyl-3-Methylene-4,5,6A,7,9A,9B-Hexahydro-3Ah-Azuleno[5,4-D]Furan-2-One; 3A,4,5,6,6A,7,9A,9B-Octahydro-4,6-Dihydroxy-6,9-Dimethyl-3-Methyleneazuleno(4,5-B)Furan-2(3H)-One (3Ar-(3Aalpha,4Alpha,6Alpha,6Aalpha,9Aalpha,9Bbeta))-; Artenovin |
| Molecular Structure |  |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 21982-83-2 |
| SMILES | CC2(C3C(C1C(C(=C)C(O1)=O)C(C2)O)C(=CC3)C)O |
| InChI | 1S/C15H20O4/c1-7-4-5-9-11(7)13-12(8(2)14(17)19-13)10(16)6-15(9,3)18/h4,9-13,16,18H,2,5-6H2,1,3H3 |
| InChIKey | NKXCPQWCIOWQOE-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.887°C at 760 mmHg (Cal.) |
| Flash point | 177.023°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cumambrin B |