Online Database of Chemicals from Around the World
|
CAS#: 22020-72-0 Product: 3,4,5-Triphenylisoxazole No suppilers available for the product. |
| Name | 3,4,5-Triphenylisoxazole |
|---|---|
| Synonyms | 3,4,5-Tri(Phenyl)Isoxazole; 1,2,5-Triphenyl-3,4-Oxazole; 3,4,5-Triphenylisoxazole |
| Molecular Structure |  |
| Molecular Formula | C21H15NO |
| Molecular Weight | 297.36 |
| CAS Registry Number | 22020-72-0 |
| SMILES | C1=CC=C(C=C1)C2=C(ON=C2C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C21H15NO/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)22-23-21(19)18-14-8-3-9-15-18/h1-15H |
| InChIKey | ZVOMKZHDZNGXPN-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.501°C at 760 mmHg (Cal.) |
| Flash point | 109.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5-Triphenylisoxazole |