Online Database of Chemicals from Around the World
|
CAS#: 42454-94-4 Product: 1,2,3-Triphenyl-1-Indenol No suppilers available for the product. |
| Name | 1,2,3-Triphenyl-1-Indenol |
|---|---|
| Synonyms | 1,2,3-Tri(Phenyl)-1-Indenol; Inden-1-Ol, 1,2,3-Triphenyl-; Nsc86168 |
| Molecular Structure |  |
| Molecular Formula | C27H20O |
| Molecular Weight | 360.45 |
| CAS Registry Number | 42454-94-4 |
| SMILES | C1=CC=CC2=C1C(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)O |
| InChI | 1S/C27H20O/c28-27(22-16-8-3-9-17-22)24-19-11-10-18-23(24)25(20-12-4-1-5-13-20)26(27)21-14-6-2-7-15-21/h1-19,28H |
| InChIKey | ADZZBNYBYSNNGJ-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.392°C at 760 mmHg (Cal.) |
| Flash point | 204.43°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Triphenyl-1-Indenol |