Online Database of Chemicals from Around the World
|
CAS#: 60966-95-2 Product: (3alpha,20R)-Pregn-4-Ene-3,20-Diol No suppilers available for the product. |
| Name | (3alpha,20R)-Pregn-4-Ene-3,20-Diol |
|---|---|
| Synonyms | 4-Pregnene-3-α,20-β-diol |
| Molecular Structure |  |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.49 |
| CAS Registry Number | 60966-95-2 |
| SMILES | C[C@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C[C@@H](CC[C@]34C)O)C)O |
| InChI | 1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12-13,15-19,22-23H,4-11H2,1-3H3/t13-,15-,16+,17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | IBMZAHKIAAJREF-ONNYUIQLSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.5±18.0°C at 760 mmHg (Cal.) |
| Flash point | 199.5±15.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3alpha,20R)-Pregn-4-Ene-3,20-Diol |