Online Database of Chemicals from Around the World
|
CAS#: 22172-15-2 Product: Norswertianin No suppilers available for the product. |
| Name | Norswertianin |
|---|---|
| Synonyms | 1,2,6,8-Tetrahydroxy-9-Xanthenone; 1,2,6,8-Tetrahydroxyxanthone; 9H-Xanthen-9-One, 1,2,6,8-Tetrahydroxy- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C13H8O6 |
| Molecular Weight | 260.20 |
| CAS Registry Number | 22172-15-2 |
| SMILES | C2=C1OC3=C(C(C1=C(C=C2O)O)=O)C(=C(C=C3)O)O |
| InChI | 1S/C13H8O6/c14-5-3-7(16)10-9(4-5)19-8-2-1-6(15)12(17)11(8)13(10)18/h1-4,14-17H |
| InChIKey | RVOUOPDWADMVBA-UHFFFAOYSA-N |
| Density | 1.766g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.744°C at 760 mmHg (Cal.) |
| Flash point | 240.446°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Norswertianin |