|
CAS#: 2650-35-3 Product: Norsecurinine No suppilers available for the product. |
| Name | Norsecurinine |
|---|---|
| Synonyms | Ent-Norsecurinine; Norsecurinine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 2650-35-3 |
| SMILES | [C@H]14N([C@@H]3C=CC2=CC(OC12C3)=O)CCC4 |
| InChI | 1S/C12H13NO2/c14-11-6-8-3-4-9-7-12(8,15-11)10-2-1-5-13(9)10/h3-4,6,9-10H,1-2,5,7H2/t9-,10-,12?/m1/s1 |
| InChIKey | NBGOALXYAZVRPS-UVTZGIPTSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.839°C at 760 mmHg (Cal.) |
| Flash point | 200.885°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Norsecurinine |