Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Norstictic acid |
|---|---|
| Synonyms | Bryopogonic Acid; Ncgc00095221-02; Spectrum3_000235 |
| Molecular Structure |  |
| Molecular Formula | C18H12O9 |
| Molecular Weight | 372.29 |
| CAS Registry Number | 571-67-5 |
| SMILES | C4=C(C3=C(OC1=C(C(=C(C2=C1C(O)OC2=O)O)C)OC3=O)C(=C4O)C=O)C |
| InChI | 1S/C18H12O9/c1-5-3-8(20)7(4-19)14-9(5)16(22)26-13-6(2)12(21)10-11(15(13)25-14)18(24)27-17(10)23/h3-4,18,20-21,24H,1-2H3 |
| InChIKey | IEVVSJFLBYOUCJ-UHFFFAOYSA-N |
| Density | 1.715g/cm3 (Cal.) |
|---|---|
| Boiling point | 764.169°C at 760 mmHg (Cal.) |
| Flash point | 283.73°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Norstictic acid |