Online Database of Chemicals from Around the World
|
CAS#: 23045-13-8 Product: 3-Methyl-9-Acridinamine No suppilers available for the product. |
| Name | 3-Methyl-9-Acridinamine |
|---|---|
| Synonyms | 3-Methyl-9-Acridinamine; (3-Methylacridin-9-Yl)Amine; Brn 0159422 |
| Molecular Structure |  |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 23045-13-8 |
| SMILES | C1=C(C=CC2=C1N=C3C(=C2N)C=CC=C3)C |
| InChI | 1S/C14H12N2/c1-9-6-7-11-13(8-9)16-12-5-3-2-4-10(12)14(11)15/h2-8H,1H3,(H2,15,16) |
| InChIKey | YDNFAUYKNHHSDV-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.785°C at 760 mmHg (Cal.) |
| Flash point | 240.349°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-9-Acridinamine |