Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Methylacridine |
|---|---|
| Synonyms | 5-20-08-00251 (Beilstein Handbook Reference); Brn 0133145 |
| Molecular Structure |  |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 |
| CAS Registry Number | 613-15-0 |
| EINECS | 210-331-4 |
| SMILES | C1=CC=C2C(=C1)N=C3C(=C2)C=C(C=C3)C |
| InChI | 1S/C14H11N/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)15-14/h2-9H,1H3 |
| InChIKey | HVZWBVZEZZJOKQ-UHFFFAOYSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.862°C at 760 mmHg (Cal.) |
| Flash point | 159.954°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylacridine |