Online Database of Chemicals from Around the World
| Name | 4,10-Dimethylphenanthrene |
|---|---|
| Synonyms | Brn 1865637; Phenanthrene, 4,10-Dimethyl-; Phenanthrene, 4,10-Dimethyl |
| Molecular Structure |  |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 23189-63-1 |
| SMILES | C2=CC1=C3C(=C(C=C1C=C2)C)C=CC=C3C |
| InChI | 1S/C16H14/c1-11-6-5-9-14-12(2)10-13-7-3-4-8-15(13)16(11)14/h3-10H,1-2H3 |
| InChIKey | GNTFYOZHQKNINL-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.827°C at 760 mmHg (Cal.) |
| Flash point | 169.058°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,10-Dimethylphenanthrene |
