Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,5-Dimethylphenanthrene |
|---|---|
| Synonyms | Phenanthrene, 1,5-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 66271-87-2 |
| SMILES | C2=C(C1=C3C(=CC=C1C=C2)C(=CC=C3)C)C |
| InChI | 1S/C16H14/c1-11-5-4-8-15-14(11)10-9-13-7-3-6-12(2)16(13)15/h3-10H,1-2H3 |
| InChIKey | IEIXYWLBBKHPSQ-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.644°C at 760 mmHg (Cal.) |
| Flash point | 168.352°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethylphenanthrene |