|
CAS#: 66291-31-4 Product: 3,4-Dimethylphenanthrene No suppilers available for the product. |
| Name | 3,4-Dimethylphenanthrene |
|---|---|
| Synonyms | 3-05-00-02174 (Beilstein Handbook Reference); Brn 2518931; Ccris 4925 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 66291-31-4 |
| SMILES | C1=CC2=C(C=C1)C=CC3=C2C(=C(C=C3)C)C |
| InChI | 1S/C16H14/c1-11-7-8-14-10-9-13-5-3-4-6-15(13)16(14)12(11)2/h3-10H,1-2H3 |
| InChIKey | MVKMRUGPOSSXNO-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.989°C at 760 mmHg (Cal.) |
| Flash point | 170.947°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethylphenanthrene |