Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 10H-Phenoselenazine |
|---|---|
| Synonyms | Ccris 5876; Phenoselenazine; Phenylselenazine |
| Molecular Structure |  |
| Molecular Formula | C12H9NSe |
| Molecular Weight | 246.17 |
| CAS Registry Number | 262-05-5 |
| SMILES | C1=CC=CC2=C1[Se]C3=C(N2)C=CC=C3 |
| InChI | 1S/C12H9NSe/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| InChIKey | ILFYOWGJBKEMSK-UHFFFAOYSA-N |
| Boiling point | 424.094°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 210.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10H-Phenoselenazine |