Online Database of Chemicals from Around the World
| Name | 10H-Phenothiazine-10-Carboxamide |
|---|---|
| Synonyms | 10-Phenothiazinecarboxamide; 0-27-00-00066 (Beilstein Handbook Reference); 10H-Phenothiazine-10-Carboxamide (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.29 |
| CAS Registry Number | 4412-24-2 |
| SMILES | C3=C2N(C(=O)N)C1=CC=CC=C1SC2=CC=C3 |
| InChI | 1S/C13H10N2OS/c14-13(16)15-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)15/h1-8H,(H2,14,16) |
| InChIKey | ZIXAQGHVCPYMBA-UHFFFAOYSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.407°C at 760 mmHg (Cal.) |
| Flash point | 203.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10H-Phenothiazine-10-Carboxamide |
