Online Database of Chemicals from Around the World
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (1204) 527-700 | |||
 |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Isobornyl Benzoate |
|---|---|
| Synonyms | (1,7,7-Trimethylnorbornan-2-Yl) Benzoate; Benzoic Acid (1,7,7-Trimethyl-2-Norbornanyl) Ester; Isobornyl Benzoate |
| Molecular Structure |  |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 |
| CAS Registry Number | 26927-89-9 |
| EINECS | 248-112-0 |
| SMILES | C1=C(C=CC=C1)C(OC2CC3CCC2(C3(C)C)C)=O |
| InChI | 1S/C17H22O2/c1-16(2)13-9-10-17(16,3)14(11-13)19-15(18)12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3 |
| InChIKey | FLOISDYCXINJOB-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.872°C at 760 mmHg (Cal.) |
| Flash point | 149.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobornyl Benzoate |