Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (+/-)-Isobornyl Methyl Ether |
|---|---|
| Synonyms | (1S,2S,4R)-2-Methoxy-1,7,7-Trimethyl-Norbornane; (1S,2S,4R)-2-Methoxy-1,7,7-Trimethylnorbornane; (1S,4R,6S)-6-Methoxy-1,7,7-Trimethyl-Bicyclo[2.2.1]Heptane |
| Molecular Structure |  |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 |
| CAS Registry Number | 5331-32-8 |
| EINECS | 226-228-2 |
| SMILES | [C@@]12(C)C(C)([C@H](CC1)C[C@@H]2OC)C |
| InChI | 1S/C11H20O/c1-10(2)8-5-6-11(10,3)9(7-8)12-4/h8-9H,5-7H2,1-4H3/t8-,9+,11-/m1/s1 |
| InChIKey | ZRHVOKYSOWTPIG-WCABBAIRSA-N |
| Density | 0.929g/cm3 (Cal.) |
|---|---|
| Boiling point | 186.392°C at 760 mmHg (Cal.) |
| Flash point | 58.15°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+/-)-Isobornyl Methyl Ether |