Online Database of Chemicals from Around the World
|
CAS#: 27259-98-9 Product: Deoxynybomycin No suppilers available for the product. |
| Name | Deoxynybomycin |
|---|---|
| Synonyms | Brn 0626835; Deoxynybomycin; 2H,4H-Oxazolo(5,4,3-Ij)Pyrido(3,2-G)Quinoline-4,10(11H)-Dione, 6,8,11-Trimethyl- |
| Molecular Structure |  |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 27259-98-9 |
| SMILES | C1=C4C3=C(C2=C1C(=CC(N2C)=O)C)OCN3C(C=C4C)=O |
| InChI | 1S/C16H14N2O3/c1-8-4-12(19)17(3)14-10(8)6-11-9(2)5-13(20)18-7-21-16(14)15(11)18/h4-6H,7H2,1-3H3 |
| InChIKey | SBTFHJGTXHMDPR-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.175°C at 760 mmHg (Cal.) |
| Flash point | 238.154°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Deoxynybomycin |