Online Database of Chemicals from Around the World
|
CAS#: 71582-53-1 Product: 7-Deoxynogarol No suppilers available for the product. |
| Name | 7-Deoxynogarol |
|---|---|
| Synonyms | Nogarol,7-Deoxy; Nsc308329; U-56468 |
| Molecular Structure |  |
| Molecular Formula | C27H29NO9 |
| Molecular Weight | 511.53 |
| CAS Registry Number | 71582-53-1 |
| SMILES | C1=C(O)C4=C(C2=C1C3(OC(O2)C(O)C(N(C)C)C3O)C)C(=O)C5=C(C4=O)C(=C6C(=C5)CC(O)(CC6)C)O |
| InChI | 1S/C27H29NO9/c1-26(35)6-5-11-10(9-26)7-12-15(19(11)30)21(32)16-14(29)8-13-23(17(16)20(12)31)36-25-22(33)18(28(3)4)24(34)27(13,2)37-25/h7-8,18,22,24-25,29-30,33-35H,5-6,9H2,1-4H3 |
| InChIKey | OTDXULFSLVOPKT-UHFFFAOYSA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 834.088°C at 760 mmHg (Cal.) |
| Flash point | 458.24°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Deoxynogarol |