Online Database of Chemicals from Around the World
|
CAS#: 2757-85-9 Product: 1,3-Dimethyl-1,3-Diazinane-2,4,5,6-Tetrone No suppilers available for the product. |
| Name | 1,3-Dimethyl-1,3-Diazinane-2,4,5,6-Tetrone |
|---|---|
| Synonyms | 1,3-Dimethylhexahydropyrimidine-2,4,5,6-Tetrone; 1,3-Dimethylalloxane; 1,3-Dimethylalloxan |
| Molecular Structure |  |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 |
| CAS Registry Number | 2757-85-9 |
| EINECS | 220-417-3 |
| SMILES | CN1C(C(C(N(C)C1=O)=O)=O)=O |
| InChI | 1S/C6H6N2O4/c1-7-4(10)3(9)5(11)8(2)6(7)12/h1-2H3 |
| InChIKey | KUCNNTLJQCDKEI-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.691°C at 760 mmHg (Cal.) |
| Flash point | 107.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-1,3-Diazinane-2,4,5,6-Tetrone |