|
CAS#: 79515-54-1 Product: 3-Nitroso-1,9-Dihydropyrido[6,5-b]Indol-2-One No suppilers available for the product. |
| Name | 3-Nitroso-1,9-Dihydropyrido[6,5-b]Indol-2-One |
|---|---|
| Synonyms | 9H-Pyrido(2,3-B)Indol-2-Ol, 3-Nitroso-; 2-Hydroxy-3-Nitroso-Alpha-Carboline; 3-Nitroso-9H-Pyrido(2,3-B)Indol-2-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 |
| CAS Registry Number | 79515-54-1 |
| SMILES | C2=C1C3=C([NH]C1=CC=C2)NC(=O)C(=C3)N=O |
| InChI | 1S/C11H7N3O2/c15-11-9(14-16)5-7-6-3-1-2-4-8(6)12-10(7)13-11/h1-5H,(H2,12,13,15) |
| InChIKey | SOHXBFNBFOAFCP-UHFFFAOYSA-N |
| Density | 1.605g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.9°C at 760 mmHg (Cal.) |
| Flash point | 288.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitroso-1,9-Dihydropyrido[6,5-b]Indol-2-One |