Online Database of Chemicals from Around the World
|
CAS#: 314-04-5 Product: 3,8-Difluorotricycloquinazoline No suppilers available for the product. |
| Name | 3,8-Difluorotricycloquinazoline |
|---|---|
| Synonyms | Tricycloquinazoline, 3,8-Difluoro-; 3,8-Difluorotricycloquinazoline |
| Molecular Structure |  |
| Molecular Formula | C21H10F2N4 |
| Molecular Weight | 356.33 |
| CAS Registry Number | 314-04-5 |
| SMILES | C1=CC=C2C(=C1)C3=NC6=C(C4=NC5=C(C(=N2)N34)C=C(C=C5)F)C=C(C=C6)F |
| InChI | 1S/C21H10F2N4/c22-11-5-7-17-14(9-11)21-26-18-8-6-12(23)10-15(18)20-24-16-4-2-1-3-13(16)19(25-17)27(20)21/h1-10H |
| InChIKey | VLVFOIKZRUFWDM-UHFFFAOYSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.011°C at 760 mmHg (Cal.) |
| Flash point | 305.185°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,8-Difluorotricycloquinazoline |