|
CAS#: 936250-24-7 Product: [3,4-Difluoro-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid No suppilers available for the product. |
| Name | [3,4-Difluoro-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
|---|---|
| Synonyms | 3-(2,2,2-Trifluoro-ethoxy)-4,5-difluoro-benzeneboronic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6BF5O3 |
| Molecular Weight | 255.93 |
| CAS Registry Number | 936250-24-7 |
| SMILES | OB(O)c1cc(OCC(F)(F)F)c(F)c(F)c1 |
| InChI | 1S/C8H6BF5O3/c10-5-1-4(9(15)16)2-6(7(5)11)17-3-8(12,13)14/h1-2,15-16H,3H2 |
| InChIKey | CDDYENUINDWWMW-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.031°C at 760 mmHg (Cal.) |
| Flash point | 134.649°C (Cal.) |
| Refractive index | 1.436 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3,4-Difluoro-5-(2,2,2-trifluoroethoxy)phenyl]boronic acid |