Online Database of Chemicals from Around the World
|
CAS#: 936250-26-9 Product: [3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid No suppilers available for the product. |
| Name | [3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
|---|---|
| Synonyms | 2-(2,2,2-trifluoro-ethoxy)-3,5-difluoro-benzeneboronic acid |
| Molecular Structure | ![CAS#: 936250-26-9， [3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid](/moreStructures/936250-26-9.gif) |
| Molecular Formula | C8H6BF5O3 |
| Molecular Weight | 255.93 |
| CAS Registry Number | 936250-26-9 |
| SMILES | B(c1cc(cc(c1OCC(F)(F)F)F)F)(O)O |
| InChI | 1S/C8H6BF5O3/c10-4-1-5(9(15)16)7(6(11)2-4)17-3-8(12,13)14/h1-2,15-16H,3H2 |
| InChIKey | AZYREAMQJBZUHH-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.946°C at 760 mmHg (Cal.) |
| Flash point | 150.927°C (Cal.) |
| Refractive index | 1.436 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3,5-Difluoro-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid |