Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | N-Phenylacridin-9-Amine |
|---|---|
| Synonyms | N-Phenyl-9-Acridinamine; Acridin-9-Yl-Phenyl-Amine; 9-Acridinamine, N-Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 |
| CAS Registry Number | 3340-22-5 |
| SMILES | C2=CC=CC3=NC1=CC=CC=C1C(=C23)NC4=CC=CC=C4 |
| InChI | 1S/C19H14N2/c1-2-8-14(9-3-1)20-19-15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)19/h1-13H,(H,20,21) |
| InChIKey | LNVQBBHYPGFSMX-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.785°C at 760 mmHg (Cal.) |
| Flash point | 220.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenylacridin-9-Amine |