Online Database of Chemicals from Around the World
|
CAS#: 3343-05-3 Product: 1,2-Dihydro-Benz(j)Aceanthrylene-3-Methanol No suppilers available for the product. |
| Name | 1,2-Dihydro-Benz(j)Aceanthrylene-3-Methanol |
|---|---|
| Synonyms | 1,2-Dihydrobenz(J)Aceanthrylene-3-Methanol; 3-Hydroxymethylcholanthrene; 3-Ohmc |
| Molecular Structure |  |
| Molecular Formula | C21H16O |
| Molecular Weight | 284.36 |
| CAS Registry Number | 3343-05-3 |
| SMILES | C1=C(C5=C4C(=C1)C=C3C2=CC=CC=C2C=CC3=C4CC5)CO |
| InChI | 1S/C21H16O/c22-12-15-6-5-14-11-20-16-4-2-1-3-13(16)7-8-18(20)19-10-9-17(15)21(14)19/h1-8,11,22H,9-10,12H2 |
| InChIKey | ONZZUTGSANXYMB-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.625°C at 760 mmHg (Cal.) |
| Flash point | 243.102°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydro-Benz(j)Aceanthrylene-3-Methanol |